About 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione
3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione (PubChem CID 118734020) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione.
Molecular Properties
| Compound Name | 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione |
| PubChem CID | 118734020 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCCCCCCCCC1=C(OC)C(OC)=CC(=O)C1=O |
| InChI | InChI=1S/C20H32O4/c1-4-5-6-7-8-9-10-11-12-13-14-16-19(22)17(21)15-18(23-2)20(16)24-3/h15H,4-14H2,1-3H3 |
| InChIKey | ROJYDZSFBXLWIR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione?
The IUPAC name of 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione (CID 118734020) is 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione.
What is the SMILES notation for 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione?
The canonical SMILES for 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione is CCCCCCCCCCCCC1=C(OC)C(OC)=CC(=O)C1=O.
What is the InChIKey of 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione?
The InChIKey is ROJYDZSFBXLWIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4/c1-4-5-6-7-8-9-10-11-12-13-14-16-19(22)17(21)15-18(23-2)20(16)24-3/h15H,4-14H2,1-3H3.
What are the key properties of 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione?
3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione has a molecular weight of 336.47 g/mol, XLogP of 4.88, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecyl-4,5-dimethoxycyclohexa-3,5-diene-1,2-dione is sourced from PubChem (CID 118734020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).