C32H28N4 — CID 118734046
4-(2,5-diphenyl-3,4-dihydropyrazol-3-yl)-1,3-bis(4-methylphenyl)pyrazole (PubChem CID 118734046) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-(2,5-diphenyl-3,4-dihydropyrazol-3-yl)-1,3-bis(4-methylphenyl)pyrazole.
| Compound Name | 4-(2,5-diphenyl-3,4-dihydropyrazol-3-yl)-1,3-bis(4-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 118734046 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-(2,5-diphenyl-3,4-dihydropyrazol-3-yl)-1,3-bis(4-methylphenyl)pyrazole |
| SMILES | Cc1ccc(-c2nn(-c3ccc(C)cc3)cc2C2CC(c3ccccc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N4/c1-23-13-17-26(18-14-23)32-29(22-35(34-32)27-19-15-24(2)16-20-27)31-21-30(25-9-5-3-6-10-25)33-36(31)28-11-7-4-8-12-28/h3-20,22,31H,21H2,1-2H3 |
| InChIKey | QXVPSSJCULFBNO-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |