C42H41N5O5 — CID 118734254
benzyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-(4-phenylmethoxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 118734254) has the molecular formula C42H41N5O5 and a molecular weight of 695.82 g/mol. Its IUPAC name is benzyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-(4-phenylmethoxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | benzyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-(4-phenylmethoxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 118734254 |
| Molecular Formula | C42H41N5O5 |
| Molecular Weight | 695.82 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | benzyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-(4-phenylmethoxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | Nc1ccc(C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)OCc2ccccc2)cc1NC(=O)[C@@H](N)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H41N5O5/c43-35-22-18-31(23-38(35)46-41(49)36(44)21-17-28-15-19-33(20-16-28)51-26-29-9-3-1-4-10-29)40(48)47-39(42(50)52-27-30-11-5-2-6-12-30)24-32-25-45-37-14-8-7-13-34(32)37/h1-16,18-20,22-23,25,36,39,45H,17,21,24,26-27,43-44H2,(H,46,49)(H,47,48)/t36-,39-/m0/s1 |
| InChIKey | IUVPNCMZJKEEOP-VQIIKMDRSA-N |
| XLogP | 6.31 |
| TPSA | 161.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.82 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|