C23H31N7O5 — CID 118734263
methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 118734263) has the molecular formula C23H31N7O5 and a molecular weight of 485.55 g/mol. Its IUPAC name is methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 118734263 |
| Molecular Formula | C23H31N7O5 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccc(N)c(NC(=O)[C@@H](N)CCCN=C(N)N)c1 |
| InChI | InChI=1S/C23H31N7O5/c1-35-22(34)19(11-13-4-7-15(31)8-5-13)30-20(32)14-6-9-16(24)18(12-14)29-21(33)17(25)3-2-10-28-23(26)27/h4-9,12,17,19,31H,2-3,10-11,24-25H2,1H3,(H,29,33)(H,30,32)(H4,26,27,28)/t17-,19-/m0/s1 |
| InChIKey | JECKMXQKZJERLG-HKUYNNGSSA-N |
| XLogP | -0.19 |
| TPSA | 221.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|