C28H29N5O5 — CID 118734287
(2S)-2-[[3-amino-4-[[(2S)-2-amino-4-(4-hydroxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 118734287) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is (2S)-2-[[3-amino-4-[[(2S)-2-amino-4-(4-hydroxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[3-amino-4-[[(2S)-2-amino-4-(4-hydroxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 118734287 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (2S)-2-[[3-amino-4-[[(2S)-2-amino-4-(4-hydroxyphenyl)butanoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | Nc1cc(C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)ccc1NC(=O)[C@@H](N)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C28H29N5O5/c29-21(11-7-16-5-9-19(34)10-6-16)27(36)32-24-12-8-17(13-22(24)30)26(35)33-25(28(37)38)14-18-15-31-23-4-2-1-3-20(18)23/h1-6,8-10,12-13,15,21,25,31,34H,7,11,14,29-30H2,(H,32,36)(H,33,35)(H,37,38)/t21-,25-/m0/s1 |
| InChIKey | QFIZLFVZFOTXHE-OFVILXPXSA-N |
| XLogP | 2.78 |
| TPSA | 183.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|