About 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride
2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride (PubChem CID 118734329) has the molecular formula C18H28ClN5O
and a molecular weight of 365.91 g/mol. Its IUPAC name is 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride |
| PubChem CID | 118734329 |
| Molecular Formula | C18H28ClN5O |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride |
| SMILES | CCCCCCCCc1ccc(-c2noc(CN=C(N)N)n2)cc1.Cl |
| InChI | InChI=1S/C18H27N5O.ClH/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)17-22-16(24-23-17)13-21-18(19)20;/h9-12H,2-8,13H2,1H3,(H4,19,20,21);1H |
| InChIKey | YOMYDIOQDKKMEG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride?
The IUPAC name of 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride (CID 118734329) is 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride.
What is the SMILES notation for 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride?
The canonical SMILES for 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride is CCCCCCCCc1ccc(-c2noc(CN=C(N)N)n2)cc1.Cl.
What is the InChIKey of 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride?
The InChIKey is YOMYDIOQDKKMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O.ClH/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)17-22-16(24-23-17)13-21-18(19)20;/h9-12H,2-8,13H2,1H3,(H4,19,20,21);1H.
What are the key properties of 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride?
2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride has a molecular weight of 365.91 g/mol, XLogP of 3.83, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydrochloride is sourced from PubChem (CID 118734329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).