About 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride
2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride (PubChem CID 118734331) has the molecular formula C19H30ClN5O
and a molecular weight of 379.94 g/mol. Its IUPAC name is 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride |
| PubChem CID | 118734331 |
| Molecular Formula | C19H30ClN5O |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride |
| SMILES | CCCCCCCCc1ccc(-c2noc([C@H](C)N=C(N)N)n2)cc1.Cl |
| InChI | InChI=1S/C19H29N5O.ClH/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)17-23-18(25-24-17)14(2)22-19(20)21;/h10-14H,3-9H2,1-2H3,(H4,20,21,22);1H/t14-;/m0./s1 |
| InChIKey | WNMYDCPSLWXDJX-UQKRIMTDSA-N |
| XLogP | 4.40 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride?
The IUPAC name of 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride (CID 118734331) is 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride.
What is the SMILES notation for 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride?
The canonical SMILES for 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride is CCCCCCCCc1ccc(-c2noc([C@H](C)N=C(N)N)n2)cc1.Cl.
What is the InChIKey of 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride?
The InChIKey is WNMYDCPSLWXDJX-UQKRIMTDSA-N. The full InChI is InChI=1S/C19H29N5O.ClH/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)17-23-18(25-24-17)14(2)22-19(20)21;/h10-14H,3-9H2,1-2H3,(H4,20,21,22);1H/t14-;/m0./s1.
What are the key properties of 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride?
2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride has a molecular weight of 379.94 g/mol, XLogP of 4.40, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride is sourced from PubChem (CID 118734331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).