C25H33N9O6 — CID 118734353
4-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]piperazin-1-yl]benzoic acid (PubChem CID 118734353) has the molecular formula C25H33N9O6 and a molecular weight of 555.60 g/mol. Its IUPAC name is 4-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 118734353 |
| Molecular Formula | C25H33N9O6 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 4-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]piperazin-1-yl]benzoic acid |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(NCCN4CCN(c5ccc(C(=O)O)cc5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H33N9O6/c1-2-27-22(37)19-17(35)18(36)23(40-19)34-13-29-16-20(26)30-25(31-21(16)34)28-7-8-32-9-11-33(12-10-32)15-5-3-14(4-6-15)24(38)39/h3-6,13,17-19,23,35-36H,2,7-12H2,1H3,(H,27,37)(H,38,39)(H3,26,28,30,31)/t17-,18+,19-,23+/m0/s1 |
| InChIKey | FMQNJPHYANXUNL-QPXQOZNCSA-N |
| XLogP | -0.90 |
| TPSA | 204.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |