C28H33N9O5 — CID 118734375
(2S,3S,4R,5R)-5-[6-amino-2-[4-[4-(pyridin-4-ylmethoxy)phenyl]piperazin-1-yl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 118734375) has the molecular formula C28H33N9O5 and a molecular weight of 575.63 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[4-[4-(pyridin-4-ylmethoxy)phenyl]piperazin-1-yl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[4-[4-(pyridin-4-ylmethoxy)phenyl]piperazin-1-yl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 118734375 |
| Molecular Formula | C28H33N9O5 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[4-[4-(pyridin-4-ylmethoxy)phenyl]piperazin-1-yl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(N4CCN(c5ccc(OCc6ccncc6)cc5)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H33N9O5/c1-2-31-26(40)23-21(38)22(39)27(42-23)37-16-32-20-24(29)33-28(34-25(20)37)36-13-11-35(12-14-36)18-3-5-19(6-4-18)41-15-17-7-9-30-10-8-17/h3-10,16,21-23,27,38-39H,2,11-15H2,1H3,(H,31,40)(H2,29,33,34)/t21-,22+,23-,27+/m0/s1 |
| InChIKey | KRSDSGUJIIYWTO-NBCVKUGOSA-N |
| XLogP | 0.46 |
| TPSA | 177.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|