C21H34ClN5O — CID 118734386
2-[(1S)-2-methyl-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]propyl]guanidine;hydrochloride (PubChem CID 118734386) has the molecular formula C21H34ClN5O and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-[(1S)-2-methyl-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]propyl]guanidine;hydrochloride.
| Compound Name | 2-[(1S)-2-methyl-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]propyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 118734386 |
| Molecular Formula | C21H34ClN5O |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 2-[(1S)-2-methyl-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]propyl]guanidine;hydrochloride |
| SMILES | CCCCCCCCc1ccc(-c2noc([C@@H](N=C(N)N)C(C)C)n2)cc1.Cl |
| InChI | InChI=1S/C21H33N5O.ClH/c1-4-5-6-7-8-9-10-16-11-13-17(14-12-16)19-25-20(27-26-19)18(15(2)3)24-21(22)23;/h11-15,18H,4-10H2,1-3H3,(H4,22,23,24);1H/t18-;/m0./s1 |
| InChIKey | GDORUAPHQPQEBW-FERBBOLQSA-N |
| XLogP | 5.03 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|