C19H30ClN5O2 — CID 118734387
2-[(1S)-2-hydroxy-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride (PubChem CID 118734387) has the molecular formula C19H30ClN5O2 and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-[(1S)-2-hydroxy-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride.
| Compound Name | 2-[(1S)-2-hydroxy-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 118734387 |
| Molecular Formula | C19H30ClN5O2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[(1S)-2-hydroxy-1-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine;hydrochloride |
| SMILES | CCCCCCCCc1ccc(-c2noc([C@H](CO)N=C(N)N)n2)cc1.Cl |
| InChI | InChI=1S/C19H29N5O2.ClH/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)17-23-18(26-24-17)16(13-25)22-19(20)21;/h9-12,16,25H,2-8,13H2,1H3,(H4,20,21,22);1H/t16-;/m0./s1 |
| InChIKey | SFXQPUZNHYOLEM-NTISSMGPSA-N |
| XLogP | 3.37 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|