C20H30ClN5O — CID 118734400
3-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carboximidamide;hydrochloride (PubChem CID 118734400) has the molecular formula C20H30ClN5O and a molecular weight of 391.95 g/mol. Its IUPAC name is 3-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carboximidamide;hydrochloride.
| Compound Name | 3-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 118734400 |
| Molecular Formula | C20H30ClN5O |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-[3-(4-octylphenyl)-1,2,4-oxadiazol-5-yl]azetidine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CC(c2nc(-c3ccc(CCCCCCCC)cc3)no2)C1 |
| InChI | InChI=1S/C20H29N5O.ClH/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)18-23-19(26-24-18)17-13-25(14-17)20(21)22;/h9-12,17H,2-8,13-14H2,1H3,(H3,21,22);1H |
| InChIKey | KYBVMIAMCAGGEY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|