C24H23ClN4 — CID 118734492
N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 118734492) has the molecular formula C24H23ClN4 and a molecular weight of 402.93 g/mol. Its IUPAC name is N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 118734492 |
| Molecular Formula | C24H23ClN4 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C24H23ClN4/c1-29(2)14-13-26-24-21-15-18-5-3-4-6-19(18)16-22(21)27-23(28-24)12-9-17-7-10-20(25)11-8-17/h3-12,15-16H,13-14H2,1-2H3,(H,26,27,28)/b12-9+ |
| InChIKey | MLSHNEVKVSMHDB-FMIVXFBMSA-N |
| XLogP | 5.58 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|