C28H31N5O4 — CID 118734648
N-hydroxy-6-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-6-oxohexanamide (PubChem CID 118734648) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is N-hydroxy-6-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-6-oxohexanamide.
| Compound Name | N-hydroxy-6-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-6-oxohexanamide |
|---|---|
| PubChem CID | 118734648 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-hydroxy-6-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-6-oxohexanamide |
| SMILES | O=C(CCCCC(=O)N1C/C=C\COCc2cccc(c2)-c2ccnc(n2)Nc2cccc(c2)C1)NO |
| InChI | InChI=1S/C28H31N5O4/c34-26(32-36)11-1-2-12-27(35)33-15-3-4-16-37-20-22-8-5-9-23(17-22)25-13-14-29-28(31-25)30-24-10-6-7-21(18-24)19-33/h3-10,13-14,17-18,36H,1-2,11-12,15-16,19-20H2,(H,32,34)(H,29,30,31)/b4-3- |
| InChIKey | DVTLFDHKOVVHMP-ARJAWSKDSA-N |
| XLogP | 4.37 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|