C31H37N5O4 — CID 118734650
N-hydroxy-9-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-9-oxononanamide (PubChem CID 118734650) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is N-hydroxy-9-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-9-oxononanamide.
| Compound Name | N-hydroxy-9-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-9-oxononanamide |
|---|---|
| PubChem CID | 118734650 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | N-hydroxy-9-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]-9-oxononanamide |
| SMILES | O=C(CCCCCCCC(=O)N1C/C=C\COCc2cccc(c2)-c2ccnc(n2)Nc2cccc(c2)C1)NO |
| InChI | InChI=1S/C31H37N5O4/c37-29(35-39)14-4-2-1-3-5-15-30(38)36-18-6-7-19-40-23-25-11-8-12-26(20-25)28-16-17-32-31(34-28)33-27-13-9-10-24(21-27)22-36/h6-13,16-17,20-21,39H,1-5,14-15,18-19,22-23H2,(H,35,37)(H,32,33,34)/b7-6- |
| InChIKey | ZGLMOHGZOVHVIU-SREVYHEPSA-N |
| XLogP | 5.54 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|