C37H55N3O3 — CID 118734731
(6aS,6bS,8aS,11R,12aR,14aR)-11-[4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl]-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one (PubChem CID 118734731) has the molecular formula C37H55N3O3 and a molecular weight of 589.87 g/mol. Its IUPAC name is (6aS,6bS,8aS,11R,12aR,14aR)-11-[4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl]-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one.
| Compound Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl]-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
|---|---|
| PubChem CID | 118734731 |
| Molecular Formula | C37H55N3O3 |
| Molecular Weight | 589.87 g/mol |
| Exact Mass | 589.42 |
| IUPAC Name | (6aS,6bS,8aS,11R,12aR,14aR)-11-[4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl]-3-hydroxy-4,6a,6b,8a,11,14a-hexamethyl-7,8,9,10,12,12a,13,14-octahydropicen-2-one |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)N4CCN(CCN(C)C)CC4)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C37H55N3O3/c1-25-26-9-10-29-35(4,27(26)23-28(41)31(25)42)14-16-37(6)30-24-34(3,12-11-33(30,2)13-15-36(29,37)5)32(43)40-21-19-39(20-22-40)18-17-38(7)8/h9-10,23,30,42H,11-22,24H2,1-8H3/t30-,33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | BAPGGAXXVLKZHB-SUNMMQDUSA-N |
| XLogP | 6.32 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.87 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |