C46H54N6O5 — CID 118734955
ethyl 7-[1,3-dimethyl-5-[(4-piperazin-1-ylphenoxy)methyl]pyrazol-4-yl]-1-(2-morpholin-4-ylethyl)-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate (PubChem CID 118734955) has the molecular formula C46H54N6O5 and a molecular weight of 770.98 g/mol. Its IUPAC name is ethyl 7-[1,3-dimethyl-5-[(4-piperazin-1-ylphenoxy)methyl]pyrazol-4-yl]-1-(2-morpholin-4-ylethyl)-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate.
| Compound Name | ethyl 7-[1,3-dimethyl-5-[(4-piperazin-1-ylphenoxy)methyl]pyrazol-4-yl]-1-(2-morpholin-4-ylethyl)-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 118734955 |
| Molecular Formula | C46H54N6O5 |
| Molecular Weight | 770.98 g/mol |
| Exact Mass | 770.42 |
| IUPAC Name | ethyl 7-[1,3-dimethyl-5-[(4-piperazin-1-ylphenoxy)methyl]pyrazol-4-yl]-1-(2-morpholin-4-ylethyl)-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2cccc(-c3c(C)nn(C)c3COc3ccc(N4CCNCC4)cc3)c2n1CCN1CCOCC1 |
| InChI | InChI=1S/C46H54N6O5/c1-4-55-46(53)45-39(15-9-29-56-42-16-7-11-34-10-5-6-12-37(34)42)38-13-8-14-40(44(38)52(45)26-25-50-27-30-54-31-28-50)43-33(2)48-49(3)41(43)32-57-36-19-17-35(18-20-36)51-23-21-47-22-24-51/h5-8,10-14,16-20,47H,4,9,15,21-32H2,1-3H3 |
| InChIKey | ROIUCPMHEWDTOL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.98 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|