C19H23N3O3 — CID 118734977
(3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione (PubChem CID 118734977) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 118734977 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3S,6S)-3-[hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C(O)[C@@H]1NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C19H23N3O3/c1-5-19(3,4)16-13(11-8-6-7-9-12(11)21-16)15(23)14-18(25)20-10(2)17(24)22-14/h5-10,14-15,21,23H,1H2,2-4H3,(H,20,25)(H,22,24)/t10-,14-,15?/m0/s1 |
| InChIKey | WWTLLWSFFUIRKA-BNVJPMHFSA-N |
| XLogP | 1.67 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|