C32H32N4O7 — CID 118735128
N-[2,9-dioxo-3-(2-piperazin-1-ylethyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 118735128) has the molecular formula C32H32N4O7 and a molecular weight of 584.63 g/mol. Its IUPAC name is N-[2,9-dioxo-3-(2-piperazin-1-ylethyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[2,9-dioxo-3-(2-piperazin-1-ylethyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 118735128 |
| Molecular Formula | C32H32N4O7 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | N-[2,9-dioxo-3-(2-piperazin-1-ylethyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc5c(c4oc3=O)NC(=O)C(CCN3CCNCC3)O5)ccc2OC)c1 |
| InChI | InChI=1S/C32H32N4O7/c1-40-22-5-3-4-19(16-22)23-17-21(7-8-25(23)41-2)30(37)34-24-18-20-6-9-26-28(29(20)43-32(24)39)35-31(38)27(42-26)10-13-36-14-11-33-12-15-36/h3-9,16-18,27,33H,10-15H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | AVDOEYKWPZNQKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|