C34H35N3O7 — CID 118735131
N-[3-[2-(cyclohexylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 118735131) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is N-[3-[2-(cyclohexylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[3-[2-(cyclohexylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 118735131 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | N-[3-[2-(cyclohexylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc5c(c4oc3=O)NC(=O)C(CCNC3CCCCC3)O5)ccc2OC)c1 |
| InChI | InChI=1S/C34H35N3O7/c1-41-24-10-6-7-20(17-24)25-18-22(12-13-27(25)42-2)32(38)36-26-19-21-11-14-28-30(31(21)44-34(26)40)37-33(39)29(43-28)15-16-35-23-8-4-3-5-9-23/h6-7,10-14,17-19,23,29,35H,3-5,8-9,15-16H2,1-2H3,(H,36,38)(H,37,39) |
| InChIKey | AJFKBZPXUNLHJB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|