C34H35N3O7 — CID 118735136
N-[2,9-dioxo-3-(3-piperidin-1-ylpropyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 118735136) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is N-[2,9-dioxo-3-(3-piperidin-1-ylpropyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[2,9-dioxo-3-(3-piperidin-1-ylpropyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 118735136 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | N-[2,9-dioxo-3-(3-piperidin-1-ylpropyl)-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc5c(c4oc3=O)NC(=O)C(CCCN3CCCCC3)O5)ccc2OC)c1 |
| InChI | InChI=1S/C34H35N3O7/c1-41-24-9-6-8-21(18-24)25-19-23(12-13-27(25)42-2)32(38)35-26-20-22-11-14-28-30(31(22)44-34(26)40)36-33(39)29(43-28)10-7-17-37-15-4-3-5-16-37/h6,8-9,11-14,18-20,29H,3-5,7,10,15-17H2,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | IUAHOJURDLLHBR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|