C23H20N6O4 — CID 118735151
N-(2-aminophenyl)-4-[[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide (PubChem CID 118735151) has the molecular formula C23H20N6O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 118735151 |
| Molecular Formula | C23H20N6O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNCc2nc(-c3ccc([N+](=O)[O-])cc3)no2)cc1 |
| InChI | InChI=1S/C23H20N6O4/c24-19-3-1-2-4-20(19)26-23(30)17-7-5-15(6-8-17)13-25-14-21-27-22(28-33-21)16-9-11-18(12-10-16)29(31)32/h1-12,25H,13-14,24H2,(H,26,30) |
| InChIKey | BDRCYQNCRYTWTB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|