C23H20ClN5O2 — CID 118735155
N-(2-aminophenyl)-4-[[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide (PubChem CID 118735155) has the molecular formula C23H20ClN5O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 118735155 |
| Molecular Formula | C23H20ClN5O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNCc2nc(-c3ccccc3Cl)no2)cc1 |
| InChI | InChI=1S/C23H20ClN5O2/c24-18-6-2-1-5-17(18)22-28-21(31-29-22)14-26-13-15-9-11-16(12-10-15)23(30)27-20-8-4-3-7-19(20)25/h1-12,26H,13-14,25H2,(H,27,30) |
| InChIKey | XEVYWXCPXAPZLW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|