C26H25N3O2 — CID 118735373
4-[(Z)-1-[4-(2-aminoethoxy)phenyl]-3-imidazol-1-yl-2-phenylprop-1-enyl]phenol (PubChem CID 118735373) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[(Z)-1-[4-(2-aminoethoxy)phenyl]-3-imidazol-1-yl-2-phenylprop-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[4-(2-aminoethoxy)phenyl]-3-imidazol-1-yl-2-phenylprop-1-enyl]phenol |
|---|---|
| PubChem CID | 118735373 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[(Z)-1-[4-(2-aminoethoxy)phenyl]-3-imidazol-1-yl-2-phenylprop-1-enyl]phenol |
| SMILES | NCCOc1ccc(/C(=C(\Cn2ccnc2)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c27-14-17-31-24-12-8-22(9-13-24)26(21-6-10-23(30)11-7-21)25(18-29-16-15-28-19-29)20-4-2-1-3-5-20/h1-13,15-16,19,30H,14,17-18,27H2/b26-25+ |
| InChIKey | OGGUDPCKGYFJRT-OCEACIFDSA-N |
| XLogP | 4.59 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|