C38H58N6 — CID 118735428
(5S)-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-(4-cyclohexylbutyl)-4,5-dihydroimidazol-2-amine (PubChem CID 118735428) has the molecular formula C38H58N6 and a molecular weight of 598.92 g/mol. Its IUPAC name is (5S)-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-(4-cyclohexylbutyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-(4-cyclohexylbutyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735428 |
| Molecular Formula | C38H58N6 |
| Molecular Weight | 598.92 g/mol |
| Exact Mass | 598.47 |
| IUPAC Name | (5S)-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-1-(4-cyclohexylbutyl)-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\N(CCCC[C@H]2CN=C(N)N2CCCCC2CCCCC2)C[C@H](CCCC)N1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H58N6/c1-2-3-19-36-30-42(38(40)44(36)28-25-32-21-23-34(24-22-32)33-17-8-5-9-18-33)26-12-11-20-35-29-41-37(39)43(35)27-13-10-16-31-14-6-4-7-15-31/h5,8-9,17-18,21-24,31,35-36,40H,2-4,6-7,10-16,19-20,25-30H2,1H3,(H2,39,41)/b40-38+/t35-,36-/m0/s1 |
| InChIKey | HHKMHEZWVRZUHN-LYEPYAPCSA-N |
| XLogP | 7.93 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.92 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|