C45H58N6 — CID 118735431
(5S)-1-(4-cyclohexylbutyl)-5-[4-[(4R)-2-imino-4-(naphthalen-1-ylmethyl)-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine (PubChem CID 118735431) has the molecular formula C45H58N6 and a molecular weight of 683.00 g/mol. Its IUPAC name is (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4R)-2-imino-4-(naphthalen-1-ylmethyl)-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4R)-2-imino-4-(naphthalen-1-ylmethyl)-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735431 |
| Molecular Formula | C45H58N6 |
| Molecular Weight | 683.00 g/mol |
| Exact Mass | 682.47 |
| IUPAC Name | (5S)-1-(4-cyclohexylbutyl)-5-[4-[(4R)-2-imino-4-(naphthalen-1-ylmethyl)-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1\N(CCCC[C@H]2CN=C(N)N2CCCCC2CCCCC2)C[C@@H](Cc2cccc3ccccc23)N1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H58N6/c46-44-48-33-41(50(44)30-12-9-16-35-14-3-1-4-15-35)22-10-11-29-49-34-42(32-40-21-13-20-39-19-7-8-23-43(39)40)51(45(49)47)31-28-36-24-26-38(27-25-36)37-17-5-2-6-18-37/h2,5-8,13,17-21,23-27,35,41-42,47H,1,3-4,9-12,14-16,22,28-34H2,(H2,46,48)/b47-45+/t41-,42+/m0/s1 |
| InChIKey | VTZKFKAJLSNKNU-MMYBHDGUSA-N |
| XLogP | 9.13 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.00 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|