C40H58N6 — CID 118735437
(5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine (PubChem CID 118735437) has the molecular formula C40H58N6 and a molecular weight of 622.95 g/mol. Its IUPAC name is (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735437 |
| Molecular Formula | C40H58N6 |
| Molecular Weight | 622.95 g/mol |
| Exact Mass | 622.47 |
| IUPAC Name | (5S)-1-[2-(1-adamantyl)ethyl]-5-[4-[(4S)-4-butyl-2-imino-3-[2-(4-phenylphenyl)ethyl]imidazolidin-1-yl]butyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1/N(CCCC[C@H]2CN=C(N)N2CCC23CC4CC(CC(C4)C2)C3)C[C@H](CCCC)N1CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H58N6/c1-2-3-11-37-29-44(39(42)46(37)20-17-30-13-15-35(16-14-30)34-9-5-4-6-10-34)19-8-7-12-36-28-43-38(41)45(36)21-18-40-25-31-22-32(26-40)24-33(23-31)27-40/h4-6,9-10,13-16,31-33,36-37,42H,2-3,7-8,11-12,17-29H2,1H3,(H2,41,43)/b42-39-/t31?,32?,33?,36-,37-,40?/m0/s1 |
| InChIKey | LYQFDXNPWSMZCS-BBPWPOIVSA-N |
| XLogP | 7.78 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.95 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|