C30H49F3N6 — CID 118735441
(5S)-5-[4-[(4S)-4-butyl-3-heptyl-2-iminoimidazolidin-1-yl]butyl]-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-4,5-dihydroimidazol-2-amine (PubChem CID 118735441) has the molecular formula C30H49F3N6 and a molecular weight of 550.76 g/mol. Its IUPAC name is (5S)-5-[4-[(4S)-4-butyl-3-heptyl-2-iminoimidazolidin-1-yl]butyl]-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-5-[4-[(4S)-4-butyl-3-heptyl-2-iminoimidazolidin-1-yl]butyl]-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 118735441 |
| Molecular Formula | C30H49F3N6 |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | (5S)-5-[4-[(4S)-4-butyl-3-heptyl-2-iminoimidazolidin-1-yl]butyl]-1-[2-[3-(trifluoromethyl)phenyl]ethyl]-4,5-dihydroimidazol-2-amine |
| SMILES | [H]/N=C1/N(CCCC[C@H]2CN=C(N)N2CCc2cccc(C(F)(F)F)c2)C[C@H](CCCC)N1CCCCCCC |
| InChI | InChI=1S/C30H49F3N6/c1-3-5-7-8-10-19-39-27(15-6-4-2)23-37(29(39)35)18-11-9-16-26-22-36-28(34)38(26)20-17-24-13-12-14-25(21-24)30(31,32)33/h12-14,21,26-27,35H,3-11,15-20,22-23H2,1-2H3,(H2,34,36)/b35-29-/t26-,27-/m0/s1 |
| InChIKey | RJFLCXQIPTWBOC-NUCVFJARSA-N |
| XLogP | 6.50 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|