C25H19Cl2N3O3S — CID 118735629
1-(3,4-dichlorophenyl)-5-[4-[(4-methoxyphenyl)methylcarbamothioyl]phenyl]pyrazole-3-carboxylic acid (PubChem CID 118735629) has the molecular formula C25H19Cl2N3O3S and a molecular weight of 512.42 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5-[4-[(4-methoxyphenyl)methylcarbamothioyl]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-(3,4-dichlorophenyl)-5-[4-[(4-methoxyphenyl)methylcarbamothioyl]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 118735629 |
| Molecular Formula | C25H19Cl2N3O3S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5-[4-[(4-methoxyphenyl)methylcarbamothioyl]phenyl]pyrazole-3-carboxylic acid |
| SMILES | COc1ccc(CNC(=S)c2ccc(-c3cc(C(=O)O)nn3-c3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C25H19Cl2N3O3S/c1-33-19-9-2-15(3-10-19)14-28-24(34)17-6-4-16(5-7-17)23-13-22(25(31)32)29-30(23)18-8-11-20(26)21(27)12-18/h2-13H,14H2,1H3,(H,28,34)(H,31,32) |
| InChIKey | QTWCHVWOXHAAPT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|