C30H48O2 — CID 118735713
(1R,2R,4aS,8aS)-1-[(E,3R)-5-(4-tert-butylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 118735713) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (1R,2R,4aS,8aS)-1-[(E,3R)-5-(4-tert-butylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,8aS)-1-[(E,3R)-5-(4-tert-butylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 118735713 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (1R,2R,4aS,8aS)-1-[(E,3R)-5-(4-tert-butylphenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC(C)(C)c1ccc(/C=C/[C@](C)(O)CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)cc1 |
| InChI | InChI=1S/C30H48O2/c1-26(2,3)23-12-10-22(11-13-23)14-19-28(6,31)20-15-25-29(7)18-9-17-27(4,5)24(29)16-21-30(25,8)32/h10-14,19,24-25,31-32H,9,15-18,20-21H2,1-8H3/b19-14+/t24-,25+,28-,29-,30+/m0/s1 |
| InChIKey | XGMFTWHTXRIDSC-MHRPWXHNSA-N |
| XLogP | 7.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |