C27H40O4 — CID 118735719
4-[(E,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-hydroxy-3-methylpent-1-enyl]benzoic acid (PubChem CID 118735719) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 4-[(E,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-hydroxy-3-methylpent-1-enyl]benzoic acid.
| Compound Name | 4-[(E,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-hydroxy-3-methylpent-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 118735719 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 4-[(E,3R)-5-[(1R,2R,4aS,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-hydroxy-3-methylpent-1-enyl]benzoic acid |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CC[C@@](C)(O)/C=C/c3ccc(C(=O)O)cc3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C27H40O4/c1-24(2)14-6-15-26(4)21(24)13-18-27(5,31)22(26)12-17-25(3,30)16-11-19-7-9-20(10-8-19)23(28)29/h7-11,16,21-22,30-31H,6,12-15,17-18H2,1-5H3,(H,28,29)/b16-11+/t21-,22+,25-,26-,27+/m0/s1 |
| InChIKey | VRGCGYPUVBBCPV-MJFPORRFSA-N |
| XLogP | 5.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |