About 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile
2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 118735970) has the molecular formula C23H21N3OS
and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| PubChem CID | 118735970 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | Cc1cccc(C(=O)N2CCc3c(sc(NCc4ccccc4)c3C#N)C2)c1 |
| InChI | InChI=1S/C23H21N3OS/c1-16-6-5-9-18(12-16)23(27)26-11-10-19-20(13-24)22(28-21(19)15-26)25-14-17-7-3-2-4-8-17/h2-9,12,25H,10-11,14-15H2,1H3 |
| InChIKey | VSFGQRFAAFEAOX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile?
The IUPAC name of 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (CID 118735970) is 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
What is the SMILES notation for 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile?
The canonical SMILES for 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile is Cc1cccc(C(=O)N2CCc3c(sc(NCc4ccccc4)c3C#N)C2)c1.
What is the InChIKey of 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile?
The InChIKey is VSFGQRFAAFEAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3OS/c1-16-6-5-9-18(12-16)23(27)26-11-10-19-20(13-24)22(28-21(19)15-26)25-14-17-7-3-2-4-8-17/h2-9,12,25H,10-11,14-15H2,1H3.
What are the key properties of 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile?
2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile has a molecular weight of 387.51 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-6-(3-methylbenzoyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile is sourced from PubChem (CID 118735970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).