C26H29N3O4 — CID 118736030
ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methylphenyl)pyrazole-3-carboxylate (PubChem CID 118736030) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118736030 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl 5-[3-(cyclohexylcarbamoyloxy)phenyl]-1-(4-methylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC(=O)NC3CCCCC3)c2)n(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C26H29N3O4/c1-3-32-25(30)23-17-24(29(28-23)21-14-12-18(2)13-15-21)19-8-7-11-22(16-19)33-26(31)27-20-9-5-4-6-10-20/h7-8,11-17,20H,3-6,9-10H2,1-2H3,(H,27,31) |
| InChIKey | QZWUZXRKUQRAMF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |