About 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide
2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide (PubChem CID 118736123) has the molecular formula C21H20ClN5O
and a molecular weight of 393.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide |
| PubChem CID | 118736123 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide |
| SMILES | Cc1cc2nc(CCNC(=O)c3ccc(-n4ccnc4)cc3Cl)[nH]c2cc1C |
| InChI | InChI=1S/C21H20ClN5O/c1-13-9-18-19(10-14(13)2)26-20(25-18)5-6-24-21(28)16-4-3-15(11-17(16)22)27-8-7-23-12-27/h3-4,7-12H,5-6H2,1-2H3,(H,24,28)(H,25,26) |
| InChIKey | SKGXTSHLWZIUME-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide?
The IUPAC name of 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide (CID 118736123) is 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide.
What is the SMILES notation for 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide?
The canonical SMILES for 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide is Cc1cc2nc(CCNC(=O)c3ccc(-n4ccnc4)cc3Cl)[nH]c2cc1C.
What is the InChIKey of 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide?
The InChIKey is SKGXTSHLWZIUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN5O/c1-13-9-18-19(10-14(13)2)26-20(25-18)5-6-24-21(28)16-4-3-15(11-17(16)22)27-8-7-23-12-27/h3-4,7-12H,5-6H2,1-2H3,(H,24,28)(H,25,26).
What are the key properties of 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide?
2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide has a molecular weight of 393.88 g/mol, XLogP of 3.99, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-4-imidazol-1-ylbenzamide is sourced from PubChem (CID 118736123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).