About 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide
4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 118736324) has the molecular formula C15H16Br2N2O3S
and a molecular weight of 464.18 g/mol. Its IUPAC name is 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide |
| PubChem CID | 118736324 |
| Molecular Formula | C15H16Br2N2O3S |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 461.92 |
| IUPAC Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C15H16Br2N2O3S/c16-12-7-11(15(20)14(17)8-12)9-19-6-5-10-1-3-13(4-2-10)23(18,21)22/h1-4,7-8,19-20H,5-6,9H2,(H2,18,21,22) |
| InChIKey | KRMXVIYRZHGNAJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide?
The IUPAC name of 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide (CID 118736324) is 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide?
The canonical SMILES for 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide is NS(=O)(=O)c1ccc(CCNCc2cc(Br)cc(Br)c2O)cc1.
What is the InChIKey of 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide?
The InChIKey is KRMXVIYRZHGNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Br2N2O3S/c16-12-7-11(15(20)14(17)8-12)9-19-6-5-10-1-3-13(4-2-10)23(18,21)22/h1-4,7-8,19-20H,5-6,9H2,(H2,18,21,22).
What are the key properties of 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide?
4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide has a molecular weight of 464.18 g/mol, XLogP of 2.90, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide is sourced from PubChem (CID 118736324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).