C15H20O2 — CID 118736329
(4R,5R)-4-hydroxy-3-methyl-5-[(2E,5E)-6-methylocta-2,5,7-trien-2-yl]cyclopent-2-en-1-one (PubChem CID 118736329) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-3-methyl-5-[(2E,5E)-6-methylocta-2,5,7-trien-2-yl]cyclopent-2-en-1-one.
| Compound Name | (4R,5R)-4-hydroxy-3-methyl-5-[(2E,5E)-6-methylocta-2,5,7-trien-2-yl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 118736329 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (4R,5R)-4-hydroxy-3-methyl-5-[(2E,5E)-6-methylocta-2,5,7-trien-2-yl]cyclopent-2-en-1-one |
| SMILES | C=C/C(C)=C/C/C=C(\C)[C@H]1C(=O)C=C(C)[C@@H]1O |
| InChI | InChI=1S/C15H20O2/c1-5-10(2)7-6-8-11(3)14-13(16)9-12(4)15(14)17/h5,7-9,14-15,17H,1,6H2,2-4H3/b10-7+,11-8+/t14-,15-/m0/s1 |
| InChIKey | ZAYDNYGIHXQFGX-NVQOVWAOSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|