C24H30ClN7O2 — CID 118736370
6-[5-[4-(4-chlorophenyl)piperazin-1-yl]pentyl]-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 118736370) has the molecular formula C24H30ClN7O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 6-[5-[4-(4-chlorophenyl)piperazin-1-yl]pentyl]-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[5-[4-(4-chlorophenyl)piperazin-1-yl]pentyl]-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 118736370 |
| Molecular Formula | C24H30ClN7O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 6-[5-[4-(4-chlorophenyl)piperazin-1-yl]pentyl]-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cn1c(=O)c2c(nc3n(CCCCCN4CCN(c5ccc(Cl)cc5)CC4)ccn23)n(C)c1=O |
| InChI | InChI=1S/C24H30ClN7O2/c1-27-21-20(22(33)28(2)24(27)34)32-17-16-31(23(32)26-21)11-5-3-4-10-29-12-14-30(15-13-29)19-8-6-18(25)7-9-19/h6-9,16-17H,3-5,10-15H2,1-2H3 |
| InChIKey | IMNXUQRZOVUMFZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|