C26H35N7O2 — CID 118736375
6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 118736375) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 118736375 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 6-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2,4,7-trimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cccc(N2CCN(CCCCn3c(C)cn4c5c(=O)n(C)c(=O)n(C)c5nc34)CC2)c1C |
| InChI | InChI=1S/C26H35N7O2/c1-18-9-8-10-21(20(18)3)31-15-13-30(14-16-31)11-6-7-12-32-19(2)17-33-22-23(27-25(32)33)28(4)26(35)29(5)24(22)34/h8-10,17H,6-7,11-16H2,1-5H3 |
| InChIKey | BGCTWVTVIOEIPP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|