C19H18ClN5O — CID 118736439
3-[2-chloro-5-(propan-2-yloxymethyl)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118736439) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is 3-[2-chloro-5-(propan-2-yloxymethyl)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-(propan-2-yloxymethyl)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118736439 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[2-chloro-5-(propan-2-yloxymethyl)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1nc2ccncc2n2c(-c3cc(COC(C)C)ccc3Cl)nnc12 |
| InChI | InChI=1S/C19H18ClN5O/c1-11(2)26-10-13-4-5-15(20)14(8-13)19-24-23-18-12(3)22-16-6-7-21-9-17(16)25(18)19/h4-9,11H,10H2,1-3H3 |
| InChIKey | CTYOOSCTADWWDM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |