C16H9ClF3N5O — CID 118736441
3-[2-chloro-5-(trifluoromethoxy)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118736441) has the molecular formula C16H9ClF3N5O and a molecular weight of 379.73 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethoxy)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-[2-chloro-5-(trifluoromethoxy)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118736441 |
| Molecular Formula | C16H9ClF3N5O |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethoxy)phenyl]-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1nc2ccncc2n2c(-c3cc(OC(F)(F)F)ccc3Cl)nnc12 |
| InChI | InChI=1S/C16H9ClF3N5O/c1-8-14-23-24-15(25(14)13-7-21-5-4-12(13)22-8)10-6-9(2-3-11(10)17)26-16(18,19)20/h2-7H,1H3 |
| InChIKey | LKBVNJHZZJQSPX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |