C18H18N6O — CID 118736444
3-(5-butoxy-3-pyridinyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 118736444) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(5-butoxy-3-pyridinyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-(5-butoxy-3-pyridinyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 118736444 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-(5-butoxy-3-pyridinyl)-7-methyl-2,4,5,8,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CCCCOc1cncc(-c2nnc3c(C)nc4ccncc4n23)c1 |
| InChI | InChI=1S/C18H18N6O/c1-3-4-7-25-14-8-13(9-20-10-14)18-23-22-17-12(2)21-15-5-6-19-11-16(15)24(17)18/h5-6,8-11H,3-4,7H2,1-2H3 |
| InChIKey | IDPOAJGPSIINOF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|