C24H27ClN4O2 — CID 118736566
tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]ethyl]carbamate (PubChem CID 118736566) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118736566 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methylquinazolin-4-yl]amino]ethyl]carbamate |
| SMILES | Cc1ccc2nc(/C=C/c3ccc(Cl)cc3)nc(NCCNC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-16-5-11-20-19(15-16)22(26-13-14-27-23(30)31-24(2,3)4)29-21(28-20)12-8-17-6-9-18(25)10-7-17/h5-12,15H,13-14H2,1-4H3,(H,27,30)(H,26,28,29)/b12-8+ |
| InChIKey | LWCJFHQSSOXBDN-XYOKQWHBSA-N |
| XLogP | 5.70 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|