C25H36NO4+ — CID 11873657
[(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[2-(3,4-dimethoxyphenyl)ethyl]azanium (PubChem CID 11873657) has the molecular formula C25H36NO4+ and a molecular weight of 414.57 g/mol. Its IUPAC name is [(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[2-(3,4-dimethoxyphenyl)ethyl]azanium.
| Compound Name | [(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 11873657 |
| Molecular Formula | C25H36NO4+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [(3S,3aR,4aR,8aR,9aR)-8a-methyl-5-methylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-3-yl]methyl-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH2+]CCc4ccc(OC)c(OC)c4)[C@H]3C[C@H]12 |
| InChI | InChI=1S/C25H35NO4/c1-16-6-5-10-25(2)14-23-18(13-20(16)25)19(24(27)30-23)15-26-11-9-17-7-8-21(28-3)22(12-17)29-4/h7-8,12,18-20,23,26H,1,5-6,9-11,13-15H2,2-4H3/p+1/t18-,19-,20-,23-,25-/m1/s1 |
| InChIKey | VYLLNFJEMQLLQV-VPQQHZGJSA-O |
| XLogP | 3.12 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|