C19H20ClF6N5O — CID 118736621
(3R)-3-amino-1-[(1R,8S)-3-(trifluoromethyl)-2,4,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-10-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 118736621) has the molecular formula C19H20ClF6N5O and a molecular weight of 483.84 g/mol. Its IUPAC name is (3R)-3-amino-1-[(1R,8S)-3-(trifluoromethyl)-2,4,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-10-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[(1R,8S)-3-(trifluoromethyl)-2,4,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-10-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 118736621 |
| Molecular Formula | C19H20ClF6N5O |
| Molecular Weight | 483.84 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (3R)-3-amino-1-[(1R,8S)-3-(trifluoromethyl)-2,4,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-10-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CC[C@@H]2[C@@H](Cc3nnc(C(F)(F)F)n32)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H19F6N5O.ClH/c20-12-7-14(22)13(21)4-9(12)3-11(26)6-17(31)29-2-1-15-10(8-29)5-16-27-28-18(30(15)16)19(23,24)25;/h4,7,10-11,15H,1-3,5-6,8,26H2;1H/t10-,11+,15+;/m0./s1 |
| InChIKey | FHXLJUPJUDOTGH-MKQWSKFRSA-N |
| XLogP | 3.04 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|