C19H28O3 — CID 118736641
(3E)-5-hydroxy-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]hepta-3,6-dien-2-one (PubChem CID 118736641) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3E)-5-hydroxy-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]hepta-3,6-dien-2-one.
| Compound Name | (3E)-5-hydroxy-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]hepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 118736641 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3E)-5-hydroxy-6-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]hepta-3,6-dien-2-one |
| SMILES | C=C(C(O)/C=C/C(C)=O)[C@@H]1C[C@@H](O)[C@@]2(C)[C@@H]1[C@@H]1[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-10-5-7-14-17(10)18-13(9-16(22)19(14,18)4)12(3)15(21)8-6-11(2)20/h6,8,10,13-18,21-22H,3,5,7,9H2,1-2,4H3/b8-6+/t10-,13+,14+,15?,16-,17-,18+,19+/m1/s1 |
| InChIKey | JSPRVNRJZLYISA-CPPSQWIQSA-N |
| XLogP | 2.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|