C22H34O3 — CID 118736649
[(1S,2R,3R,5R,6R,7R,8R)-5-[(4E)-6-hydroxy-6-methylhepta-1,4-dien-2-yl]-2,8-dimethyl-3-tricyclo[5.3.0.02,6]decanyl] acetate (PubChem CID 118736649) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1S,2R,3R,5R,6R,7R,8R)-5-[(4E)-6-hydroxy-6-methylhepta-1,4-dien-2-yl]-2,8-dimethyl-3-tricyclo[5.3.0.02,6]decanyl] acetate.
| Compound Name | [(1S,2R,3R,5R,6R,7R,8R)-5-[(4E)-6-hydroxy-6-methylhepta-1,4-dien-2-yl]-2,8-dimethyl-3-tricyclo[5.3.0.02,6]decanyl] acetate |
|---|---|
| PubChem CID | 118736649 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1S,2R,3R,5R,6R,7R,8R)-5-[(4E)-6-hydroxy-6-methylhepta-1,4-dien-2-yl]-2,8-dimethyl-3-tricyclo[5.3.0.02,6]decanyl] acetate |
| SMILES | C=C(C/C=C/C(C)(C)O)[C@@H]1C[C@@H](OC(C)=O)[C@@]2(C)[C@@H]1[C@@H]1[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C22H34O3/c1-13(8-7-11-21(4,5)24)16-12-18(25-15(3)23)22(6)17-10-9-14(2)19(17)20(16)22/h7,11,14,16-20,24H,1,8-10,12H2,2-6H3/b11-7+/t14-,16+,17+,18-,19-,20+,22+/m1/s1 |
| InChIKey | ZEEQHLSDIXVRQY-AWSVRUDUSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|