C22H34O3 — CID 118736653
[2-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-6-methylhepta-1,5-dien-4-yl] acetate (PubChem CID 118736653) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [2-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-6-methylhepta-1,5-dien-4-yl] acetate.
| Compound Name | [2-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-6-methylhepta-1,5-dien-4-yl] acetate |
|---|---|
| PubChem CID | 118736653 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [2-[(1R,2R,3R,5R,6R,7S,10R)-5-hydroxy-6,10-dimethyl-3-tricyclo[5.3.0.02,6]decanyl]-6-methylhepta-1,5-dien-4-yl] acetate |
| SMILES | C=C(CC(C=C(C)C)OC(C)=O)[C@@H]1C[C@@H](O)[C@@]2(C)[C@@H]1[C@@H]1[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C22H34O3/c1-12(2)9-16(25-15(5)23)10-14(4)17-11-19(24)22(6)18-8-7-13(3)20(18)21(17)22/h9,13,16-21,24H,4,7-8,10-11H2,1-3,5-6H3/t13-,16?,17+,18+,19-,20-,21+,22+/m1/s1 |
| InChIKey | LUPDHBLMFRBDDB-GAQFUSPISA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|