About 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol
2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol (PubChem CID 118736694) has the molecular formula C12H11N3OS2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol |
| PubChem CID | 118736694 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol |
| SMILES | OCCNc1snc2cc(-c3ccsc3)cnc12 |
| InChI | InChI=1S/C12H11N3OS2/c16-3-2-13-12-11-10(15-18-12)5-9(6-14-11)8-1-4-17-7-8/h1,4-7,13,16H,2-3H2 |
| InChIKey | ZMJZPQIYRUXZIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol?
The IUPAC name of 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol (CID 118736694) is 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol.
What is the SMILES notation for 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol?
The canonical SMILES for 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol is OCCNc1snc2cc(-c3ccsc3)cnc12.
What is the InChIKey of 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol?
The InChIKey is ZMJZPQIYRUXZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3OS2/c16-3-2-13-12-11-10(15-18-12)5-9(6-14-11)8-1-4-17-7-8/h1,4-7,13,16H,2-3H2.
What are the key properties of 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol?
2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol has a molecular weight of 277.37 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-yl)amino]ethanol is sourced from PubChem (CID 118736694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).