About 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one
4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one (PubChem CID 118736863) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one |
| PubChem CID | 118736863 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one |
| SMILES | Cn1c(=O)cc(N)c2cc(-c3cncs3)ccc21 |
| InChI | InChI=1S/C13H11N3OS/c1-16-11-3-2-8(12-6-15-7-18-12)4-9(11)10(14)5-13(16)17/h2-7H,14H2,1H3 |
| InChIKey | ZSSLQHTYYXEMJM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one?
The IUPAC name of 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one (CID 118736863) is 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one.
What is the SMILES notation for 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one?
The canonical SMILES for 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one is Cn1c(=O)cc(N)c2cc(-c3cncs3)ccc21.
What is the InChIKey of 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one?
The InChIKey is ZSSLQHTYYXEMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS/c1-16-11-3-2-8(12-6-15-7-18-12)4-9(11)10(14)5-13(16)17/h2-7H,14H2,1H3.
What are the key properties of 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one?
4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one has a molecular weight of 257.32 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one is sourced from PubChem (CID 118736863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).