About 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione
3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione (PubChem CID 118736978) has the molecular formula C22H16N2O4S
and a molecular weight of 404.45 g/mol. Its IUPAC name is 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
Molecular Properties
| Compound Name | 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| PubChem CID | 118736978 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)NC3(C2=O)c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C22H16N2O4S/c1-14-10-12-15(13-11-14)29(27,28)24-20(25)22(23-21(24)26)18-8-4-2-6-16(18)17-7-3-5-9-19(17)22/h2-13H,1H3,(H,23,26) |
| InChIKey | AHFHQKJSBFLHCS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The IUPAC name of 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione (CID 118736978) is 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
What is the SMILES notation for 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The canonical SMILES for 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione is Cc1ccc(S(=O)(=O)N2C(=O)NC3(C2=O)c2ccccc2-c2ccccc23)cc1.
What is the InChIKey of 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The InChIKey is AHFHQKJSBFLHCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O4S/c1-14-10-12-15(13-11-14)29(27,28)24-20(25)22(23-21(24)26)18-8-4-2-6-16(18)17-7-3-5-9-19(17)22/h2-13H,1H3,(H,23,26).
What are the key properties of 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione has a molecular weight of 404.45 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-methylphenyl)sulfonylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione is sourced from PubChem (CID 118736978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).